About fluoro methanesulfonate;1,1,2,2-tetrafluoroethane
fluoro methanesulfonate;1,1,2,2-tetrafluoroethane (PubChem CID 121394090) has the molecular formula C3H5F5O3S
and a molecular weight of 216.13 g/mol. Its IUPAC name is fluoro methanesulfonate;1,1,2,2-tetrafluoroethane.
Molecular Properties
| Compound Name | fluoro methanesulfonate;1,1,2,2-tetrafluoroethane |
| PubChem CID | 121394090 |
| Molecular Formula | C3H5F5O3S |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | fluoro methanesulfonate;1,1,2,2-tetrafluoroethane |
| SMILES | CS(=O)(=O)OF.FC(F)C(F)F |
| InChI | InChI=1S/C2H2F4.CH3FO3S/c3-1(4)2(5)6;1-6(3,4)5-2/h1-2H;1H3 |
| InChIKey | HMYQIYKTHSXAED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze fluoro methanesulfonate;1,1,2,2-tetrafluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro methanesulfonate;1,1,2,2-tetrafluoroethane?
The IUPAC name of fluoro methanesulfonate;1,1,2,2-tetrafluoroethane (CID 121394090) is fluoro methanesulfonate;1,1,2,2-tetrafluoroethane.
What is the SMILES notation for fluoro methanesulfonate;1,1,2,2-tetrafluoroethane?
The canonical SMILES for fluoro methanesulfonate;1,1,2,2-tetrafluoroethane is CS(=O)(=O)OF.FC(F)C(F)F.
What is the InChIKey of fluoro methanesulfonate;1,1,2,2-tetrafluoroethane?
The InChIKey is HMYQIYKTHSXAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F4.CH3FO3S/c3-1(4)2(5)6;1-6(3,4)5-2/h1-2H;1H3.
What are the key properties of fluoro methanesulfonate;1,1,2,2-tetrafluoroethane?
fluoro methanesulfonate;1,1,2,2-tetrafluoroethane has a molecular weight of 216.13 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro methanesulfonate;1,1,2,2-tetrafluoroethane is sourced from PubChem (CID 121394090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).