C16H26N2O10 — CID 121395507
2-[[5-(1,2-dicarboxyethylamino)-6-ethoxy-6-oxohexyl]amino]butanedioic acid (PubChem CID 121395507) has the molecular formula C16H26N2O10 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-[[5-(1,2-dicarboxyethylamino)-6-ethoxy-6-oxohexyl]amino]butanedioic acid.
| Compound Name | 2-[[5-(1,2-dicarboxyethylamino)-6-ethoxy-6-oxohexyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 121395507 |
| Molecular Formula | C16H26N2O10 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[[5-(1,2-dicarboxyethylamino)-6-ethoxy-6-oxohexyl]amino]butanedioic acid |
| SMILES | CCOC(=O)C(CCCCNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N2O10/c1-2-28-16(27)9(18-11(15(25)26)8-13(21)22)5-3-4-6-17-10(14(23)24)7-12(19)20/h9-11,17-18H,2-8H2,1H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | XDVMHEPKEIPFLN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|