C36H28N4O5S2 — CID 121395548
4-benzoyl-N-[3-[2-[5-[(Z)-(3-but-3-ynyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide (PubChem CID 121395548) has the molecular formula C36H28N4O5S2 and a molecular weight of 660.78 g/mol. Its IUPAC name is 4-benzoyl-N-[3-[2-[5-[(Z)-(3-but-3-ynyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide.
| Compound Name | 4-benzoyl-N-[3-[2-[5-[(Z)-(3-but-3-ynyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 121395548 |
| Molecular Formula | C36H28N4O5S2 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 4-benzoyl-N-[3-[2-[5-[(Z)-(3-but-3-ynyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide |
| SMILES | C#CCCN1C(=O)S/C(=C\c2ccc(Sc3nc4ccccc4n3CCCNC(=O)c3ccc(C(=O)c4ccccc4)cc3)o2)C1=O |
| InChI | InChI=1S/C36H28N4O5S2/c1-2-3-21-40-34(43)30(46-36(40)44)23-27-18-19-31(45-27)47-35-38-28-12-7-8-13-29(28)39(35)22-9-20-37-33(42)26-16-14-25(15-17-26)32(41)24-10-5-4-6-11-24/h1,4-8,10-19,23H,3,9,20-22H2,(H,37,42)/b30-23- |
| InChIKey | QGFJZJYSFFQANO-WMMMYUQOSA-N |
| XLogP | 6.89 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|