C31H35N5O5S2 — CID 121395552
N-[2-[3-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propylamino]-2-oxoethyl]-N-prop-2-ynylpentanamide (PubChem CID 121395552) has the molecular formula C31H35N5O5S2 and a molecular weight of 621.79 g/mol. Its IUPAC name is N-[2-[3-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propylamino]-2-oxoethyl]-N-prop-2-ynylpentanamide.
| Compound Name | N-[2-[3-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propylamino]-2-oxoethyl]-N-prop-2-ynylpentanamide |
|---|---|
| PubChem CID | 121395552 |
| Molecular Formula | C31H35N5O5S2 |
| Molecular Weight | 621.79 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | N-[2-[3-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propylamino]-2-oxoethyl]-N-prop-2-ynylpentanamide |
| SMILES | C#CCN(CC(=O)NCCCn1c(Sc2ccc(/C=C3\SC(=O)N(C(C)C)C3=O)o2)nc2ccccc21)C(=O)CCCC |
| InChI | InChI=1S/C31H35N5O5S2/c1-5-7-13-27(38)34(17-6-2)20-26(37)32-16-10-18-35-24-12-9-8-11-23(24)33-30(35)43-28-15-14-22(41-28)19-25-29(39)36(21(3)4)31(40)42-25/h2,8-9,11-12,14-15,19,21H,5,7,10,13,16-18,20H2,1,3-4H3,(H,32,37)/b25-19- |
| InChIKey | JJMIVAUFPAKKHS-PLRJNAJWSA-N |
| XLogP | 5.38 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.79 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|