C25H21N5O4S2 — CID 121395596
1-[3-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propyl]-3-phenylurea (PubChem CID 121395596) has the molecular formula C25H21N5O4S2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 1-[3-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propyl]-3-phenylurea.
| Compound Name | 1-[3-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propyl]-3-phenylurea |
|---|---|
| PubChem CID | 121395596 |
| Molecular Formula | C25H21N5O4S2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 1-[3-[(5Z)-5-[[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propyl]-3-phenylurea |
| SMILES | O=C(NCCCN1C(=O)S/C(=C\c2ccc(Sc3nc4ccccc4[nH]3)o2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H21N5O4S2/c31-22-20(15-17-11-12-21(34-17)36-24-28-18-9-4-5-10-19(18)29-24)35-25(33)30(22)14-6-13-26-23(32)27-16-7-2-1-3-8-16/h1-5,7-12,15H,6,13-14H2,(H,28,29)(H2,26,27,32)/b20-15- |
| InChIKey | UYZCZTCFRVEMAO-HKWRFOASSA-N |
| XLogP | 5.56 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|