C19H14F3N3O4S2 — CID 121395607
(5Z)-3-propan-2-yl-5-[[5-[[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 121395607) has the molecular formula C19H14F3N3O4S2 and a molecular weight of 469.47 g/mol. Its IUPAC name is (5Z)-3-propan-2-yl-5-[[5-[[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-propan-2-yl-5-[[5-[[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121395607 |
| Molecular Formula | C19H14F3N3O4S2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (5Z)-3-propan-2-yl-5-[[5-[[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]sulfanyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)S/C(=C\c2ccc(Sc3nc4ccc(OC(F)(F)F)cc4[nH]3)o2)C1=O |
| InChI | InChI=1S/C19H14F3N3O4S2/c1-9(2)25-16(26)14(30-18(25)27)8-10-4-6-15(28-10)31-17-23-12-5-3-11(7-13(12)24-17)29-19(20,21)22/h3-9H,1-2H3,(H,23,24)/b14-8- |
| InChIKey | HUZSXRRGKVHRLD-ZSOIEALJSA-N |
| XLogP | 5.65 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|