C18H14N4O5S2 — CID 121395608
(5Z)-5-[[5-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 121395608) has the molecular formula C18H14N4O5S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is (5Z)-5-[[5-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121395608 |
| Molecular Formula | C18H14N4O5S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | (5Z)-5-[[5-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]furan-2-yl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)S/C(=C\c2ccc(Sc3nc4ccc([N+](=O)[O-])cc4[nH]3)o2)C1=O |
| InChI | InChI=1S/C18H14N4O5S2/c1-9(2)21-16(23)14(28-18(21)24)8-11-4-6-15(27-11)29-17-19-12-5-3-10(22(25)26)7-13(12)20-17/h3-9H,1-2H3,(H,19,20)/b14-8- |
| InChIKey | MFZDOHADQMTDAT-ZSOIEALJSA-N |
| XLogP | 4.66 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|