C26H25F2NO9 — CID 121396405
(2S,3S,4S,5R,6S)-6-[4,6-difluoro-5-[4-[(2S)-oxan-2-yl]phenyl]-1H-indole-3-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 121396405) has the molecular formula C26H25F2NO9 and a molecular weight of 533.48 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4,6-difluoro-5-[4-[(2S)-oxan-2-yl]phenyl]-1H-indole-3-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4,6-difluoro-5-[4-[(2S)-oxan-2-yl]phenyl]-1H-indole-3-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 121396405 |
| Molecular Formula | C26H25F2NO9 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4,6-difluoro-5-[4-[(2S)-oxan-2-yl]phenyl]-1H-indole-3-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)c1c[nH]c2cc(F)c(-c3ccc([C@@H]4CCCCO4)cc3)c(F)c12 |
| InChI | InChI=1S/C26H25F2NO9/c27-14-9-15-18(19(28)17(14)12-6-4-11(5-7-12)16-3-1-2-8-36-16)13(10-29-15)25(35)38-26-22(32)20(30)21(31)23(37-26)24(33)34/h4-7,9-10,16,20-23,26,29-32H,1-3,8H2,(H,33,34)/t16-,20-,21-,22+,23-,26-/m0/s1 |
| InChIKey | GZCJKJJWOUAGMR-WBTGXFMPSA-N |
| XLogP | 2.40 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |