C23H21Cl2F3N6O2 — CID 121397036
N-[2-[N-cyano-N'-[3-(2,2,2-trifluoroethyl)phenyl]carbamimidoyl]-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide (PubChem CID 121397036) has the molecular formula C23H21Cl2F3N6O2 and a molecular weight of 541.36 g/mol. Its IUPAC name is N-[2-[N-cyano-N'-[3-(2,2,2-trifluoroethyl)phenyl]carbamimidoyl]-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide.
| Compound Name | N-[2-[N-cyano-N'-[3-(2,2,2-trifluoroethyl)phenyl]carbamimidoyl]-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 121397036 |
| Molecular Formula | C23H21Cl2F3N6O2 |
| Molecular Weight | 541.36 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | N-[2-[N-cyano-N'-[3-(2,2,2-trifluoroethyl)phenyl]carbamimidoyl]-5-(3,4-dichlorophenyl)-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide |
| SMILES | CCN(C(=O)CO)C1CN(/C(=N/c2cccc(CC(F)(F)F)c2)NC#N)N=C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2F3N6O2/c1-2-33(20(36)12-35)19-11-34(32-21(19)15-6-7-17(24)18(25)9-15)22(30-13-29)31-16-5-3-4-14(8-16)10-23(26,27)28/h3-9,19,35H,2,10-12H2,1H3,(H,30,31) |
| InChIKey | HFGPNWMIXULCHO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|