About methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate
methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate (PubChem CID 121397483) has the molecular formula C19H22F2N2O3S
and a molecular weight of 396.46 g/mol. Its IUPAC name is methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate.
Molecular Properties
| Compound Name | methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate |
| PubChem CID | 121397483 |
| Molecular Formula | C19H22F2N2O3S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate |
| SMILES | COC(=O)c1cc(OC2CCN(CC(F)F)CC2)cc(-c2ncc(C)s2)c1 |
| InChI | InChI=1S/C19H22F2N2O3S/c1-12-10-22-18(27-12)13-7-14(19(24)25-2)9-16(8-13)26-15-3-5-23(6-4-15)11-17(20)21/h7-10,15,17H,3-6,11H2,1-2H3 |
| InChIKey | CAEKKNIPJMGAOI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate?
The IUPAC name of methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate (CID 121397483) is methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate.
What is the SMILES notation for methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate?
The canonical SMILES for methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate is COC(=O)c1cc(OC2CCN(CC(F)F)CC2)cc(-c2ncc(C)s2)c1.
What is the InChIKey of methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate?
The InChIKey is CAEKKNIPJMGAOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N2O3S/c1-12-10-22-18(27-12)13-7-14(19(24)25-2)9-16(8-13)26-15-3-5-23(6-4-15)11-17(20)21/h7-10,15,17H,3-6,11H2,1-2H3.
What are the key properties of methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate?
methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate has a molecular weight of 396.46 g/mol, XLogP of 4.01, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-5-(5-methyl-1,3-thiazol-2-yl)benzoate is sourced from PubChem (CID 121397483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).