About 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride
8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride (PubChem CID 121398353) has the molecular formula C14H11BrClN3O5S
and a molecular weight of 448.68 g/mol. Its IUPAC name is 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride |
| PubChem CID | 121398353 |
| Molecular Formula | C14H11BrClN3O5S |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 446.93 |
| IUPAC Name | 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride |
| SMILES | Cc1cc(Cn2c(=O)c3cc(S(=O)(=O)Cl)cc(Br)c3n(C)c2=O)on1 |
| InChI | InChI=1S/C14H11BrClN3O5S/c1-7-3-8(24-17-7)6-19-13(20)10-4-9(25(16,22)23)5-11(15)12(10)18(2)14(19)21/h3-5H,6H2,1-2H3 |
| InChIKey | YHDKVQVWXWDWEQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride?
The IUPAC name of 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride (CID 121398353) is 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride.
What is the SMILES notation for 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride?
The canonical SMILES for 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride is Cc1cc(Cn2c(=O)c3cc(S(=O)(=O)Cl)cc(Br)c3n(C)c2=O)on1.
What is the InChIKey of 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride?
The InChIKey is YHDKVQVWXWDWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrClN3O5S/c1-7-3-8(24-17-7)6-19-13(20)10-4-9(25(16,22)23)5-11(15)12(10)18(2)14(19)21/h3-5H,6H2,1-2H3.
What are the key properties of 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride?
8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride has a molecular weight of 448.68 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,4-dioxoquinazoline-6-sulfonyl chloride is sourced from PubChem (CID 121398353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).