C18H18N4O7S — CID 121398549
3-methyl-N-(1-methylcyclopropyl)-1-[(5-nitrofuran-2-yl)methyl]-2,4-dioxoquinazoline-6-sulfonamide (PubChem CID 121398549) has the molecular formula C18H18N4O7S and a molecular weight of 434.43 g/mol. Its IUPAC name is 3-methyl-N-(1-methylcyclopropyl)-1-[(5-nitrofuran-2-yl)methyl]-2,4-dioxoquinazoline-6-sulfonamide.
| Compound Name | 3-methyl-N-(1-methylcyclopropyl)-1-[(5-nitrofuran-2-yl)methyl]-2,4-dioxoquinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 121398549 |
| Molecular Formula | C18H18N4O7S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 3-methyl-N-(1-methylcyclopropyl)-1-[(5-nitrofuran-2-yl)methyl]-2,4-dioxoquinazoline-6-sulfonamide |
| SMILES | Cn1c(=O)c2cc(S(=O)(=O)NC3(C)CC3)ccc2n(Cc2ccc([N+](=O)[O-])o2)c1=O |
| InChI | InChI=1S/C18H18N4O7S/c1-18(7-8-18)19-30(27,28)12-4-5-14-13(9-12)16(23)20(2)17(24)21(14)10-11-3-6-15(29-11)22(25)26/h3-6,9,19H,7-8,10H2,1-2H3 |
| InChIKey | MCLKGPKVTQFZKZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|