C10H2N4S3 — CID 121399019
2-([1,3]dithiolo[4,5-f][2,1,3]benzothiadiazol-6-ylidene)propanedinitrile (PubChem CID 121399019) has the molecular formula C10H2N4S3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-([1,3]dithiolo[4,5-f][2,1,3]benzothiadiazol-6-ylidene)propanedinitrile.
| Compound Name | 2-([1,3]dithiolo[4,5-f][2,1,3]benzothiadiazol-6-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 121399019 |
| Molecular Formula | C10H2N4S3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 2-([1,3]dithiolo[4,5-f][2,1,3]benzothiadiazol-6-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1Sc2cc3nsnc3cc2S1 |
| InChI | InChI=1S/C10H2N4S3/c11-3-5(4-12)10-15-8-1-6-7(14-17-13-6)2-9(8)16-10/h1-2H |
| InChIKey | UQLOOYVNMVDQHK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|