C26H40O4 — CID 121399573
[2-methoxy-3,5-dimethyl-4-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-yl] acetate (PubChem CID 121399573) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [2-methoxy-3,5-dimethyl-4-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-yl] acetate.
| Compound Name | [2-methoxy-3,5-dimethyl-4-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 121399573 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [2-methoxy-3,5-dimethyl-4-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-yl] acetate |
| SMILES | COC1=C(C)C(=O)C(C)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1OC(C)=O |
| InChI | InChI=1S/C26H40O4/c1-17(2)11-9-12-18(3)13-10-14-19(4)15-16-23-20(5)24(28)21(6)25(29-8)26(23)30-22(7)27/h11,13,15,20,23,26H,9-10,12,14,16H2,1-8H3/b18-13+,19-15+ |
| InChIKey | ORPIERPGUNETGV-HQSZAHFGSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|