C17H22F2O4 — CID 121399941
2,2-difluoro-5-methyl-3-(tricyclo[3.3.1.02,7]non-2-ene-5-carbonyloxy)hexanoic acid (PubChem CID 121399941) has the molecular formula C17H22F2O4 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2,2-difluoro-5-methyl-3-(tricyclo[3.3.1.02,7]non-2-ene-5-carbonyloxy)hexanoic acid.
| Compound Name | 2,2-difluoro-5-methyl-3-(tricyclo[3.3.1.02,7]non-2-ene-5-carbonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 121399941 |
| Molecular Formula | C17H22F2O4 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2,2-difluoro-5-methyl-3-(tricyclo[3.3.1.02,7]non-2-ene-5-carbonyloxy)hexanoic acid |
| SMILES | CC(C)CC(OC(=O)C12CC=C3C(CC3C1)C2)C(F)(F)C(=O)O |
| InChI | InChI=1S/C17H22F2O4/c1-9(2)5-13(17(18,19)14(20)21)23-15(22)16-4-3-12-10(7-16)6-11(12)8-16/h3,9-11,13H,4-8H2,1-2H3,(H,20,21) |
| InChIKey | GFXITORZERYEDH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|