C32H45N — CID 121400037
(3Z,5E)-5-[(3E)-hexa-1,3-dien-3-yl]-9-hex-1-en-3-yl-1-[(1E)-3-methylidenehepta-1,6-dienyl]-2,7,7a,8,9,11a-hexahydro-1-benzazonine (PubChem CID 121400037) has the molecular formula C32H45N and a molecular weight of 443.72 g/mol. Its IUPAC name is (3Z,5E)-5-[(3E)-hexa-1,3-dien-3-yl]-9-hex-1-en-3-yl-1-[(1E)-3-methylidenehepta-1,6-dienyl]-2,7,7a,8,9,11a-hexahydro-1-benzazonine.
| Compound Name | (3Z,5E)-5-[(3E)-hexa-1,3-dien-3-yl]-9-hex-1-en-3-yl-1-[(1E)-3-methylidenehepta-1,6-dienyl]-2,7,7a,8,9,11a-hexahydro-1-benzazonine |
|---|---|
| PubChem CID | 121400037 |
| Molecular Formula | C32H45N |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | (3Z,5E)-5-[(3E)-hexa-1,3-dien-3-yl]-9-hex-1-en-3-yl-1-[(1E)-3-methylidenehepta-1,6-dienyl]-2,7,7a,8,9,11a-hexahydro-1-benzazonine |
| SMILES | C=CCCC(=C)/C=C/N1C/C=C\C(/C(C=C)=C/CC)=CCC2CC(C(C=C)CCC)C=CC21 |
| InChI | InChI=1S/C32H45N/c1-7-12-16-26(6)22-24-33-23-13-17-29(27(10-4)14-8-2)18-19-31-25-30(20-21-32(31)33)28(11-5)15-9-3/h7,10-11,13-14,17-18,20-22,24,28,30-32H,1,4-6,8-9,12,15-16,19,23,25H2,2-3H3/b17-13-,24-22+,27-14+,29-18+ |
| InChIKey | BIIQXVMTIFIARU-AQIPWPTRSA-N |
| XLogP | 8.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|