C33H38N4O5 — CID 121400165
3-[3-[[1-[2-[amino-(2-methylphenyl)carbamoyl]-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]-3-cyclopropyl-N-oxopropanamide (PubChem CID 121400165) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is 3-[3-[[1-[2-[amino-(2-methylphenyl)carbamoyl]-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]-3-cyclopropyl-N-oxopropanamide.
| Compound Name | 3-[3-[[1-[2-[amino-(2-methylphenyl)carbamoyl]-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]-3-cyclopropyl-N-oxopropanamide |
|---|---|
| PubChem CID | 121400165 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 3-[3-[[1-[2-[amino-(2-methylphenyl)carbamoyl]-5-methoxyphenyl]piperidin-4-yl]methoxy]phenyl]-3-cyclopropyl-N-oxopropanamide |
| SMILES | COc1ccc(C(=O)N(N)c2ccccc2C)c(N2CCC(COc3cccc(C(CC(=O)N=O)C4CC4)c3)CC2)c1 |
| InChI | InChI=1S/C33H38N4O5/c1-22-6-3-4-9-30(22)37(34)33(39)28-13-12-26(41-2)19-31(28)36-16-14-23(15-17-36)21-42-27-8-5-7-25(18-27)29(24-10-11-24)20-32(38)35-40/h3-9,12-13,18-19,23-24,29H,10-11,14-17,20-21,34H2,1-2H3 |
| InChIKey | NFJYULGOUQVUAX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|