C15H26O3 — CID 121400218
8-methoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-1,9-diol (PubChem CID 121400218) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 8-methoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-1,9-diol.
| Compound Name | 8-methoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-1,9-diol |
|---|---|
| PubChem CID | 121400218 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 8-methoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-1,9-diol |
| SMILES | COC1CCCC2CC3CCCC(O)C3C(O)C21 |
| InChI | InChI=1S/C15H26O3/c1-18-12-7-3-5-10-8-9-4-2-6-11(16)13(9)15(17)14(10)12/h9-17H,2-8H2,1H3 |
| InChIKey | LPVXPRUEINCTEW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |