About 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine
6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine (PubChem CID 121401105) has the molecular formula C22H25BrN2OS2
and a molecular weight of 477.49 g/mol. Its IUPAC name is 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine |
| PubChem CID | 121401105 |
| Molecular Formula | C22H25BrN2OS2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine |
| SMILES | Brc1cccc2c1Sc1ccc(N[C@@H]3CCCC[C@@H]3N3CCOCC3)cc1S2 |
| InChI | InChI=1S/C22H25BrN2OS2/c23-16-4-3-7-20-22(16)28-19-9-8-15(14-21(19)27-20)24-17-5-1-2-6-18(17)25-10-12-26-13-11-25/h3-4,7-9,14,17-18,24H,1-2,5-6,10-13H2/t17-,18+/m1/s1 |
| InChIKey | GIGNEOWJDMYCNJ-MSOLQXFVSA-N |
| XLogP | 6.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine?
The IUPAC name of 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine (CID 121401105) is 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine.
What is the SMILES notation for 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine?
The canonical SMILES for 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine is Brc1cccc2c1Sc1ccc(N[C@@H]3CCCC[C@@H]3N3CCOCC3)cc1S2.
What is the InChIKey of 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine?
The InChIKey is GIGNEOWJDMYCNJ-MSOLQXFVSA-N. The full InChI is InChI=1S/C22H25BrN2OS2/c23-16-4-3-7-20-22(16)28-19-9-8-15(14-21(19)27-20)24-17-5-1-2-6-18(17)25-10-12-26-13-11-25/h3-4,7-9,14,17-18,24H,1-2,5-6,10-13H2/t17-,18+/m1/s1.
What are the key properties of 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine?
6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine has a molecular weight of 477.49 g/mol, XLogP of 6.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(1R,2S)-2-morpholin-4-ylcyclohexyl]thianthren-2-amine is sourced from PubChem (CID 121401105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).