C17H33N3O4 — CID 121401219
tert-butyl N-[(2R)-1,4-dimorpholin-4-ylbutan-2-yl]carbamate (PubChem CID 121401219) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1,4-dimorpholin-4-ylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1,4-dimorpholin-4-ylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 121401219 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl N-[(2R)-1,4-dimorpholin-4-ylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCN1CCOCC1)CN1CCOCC1 |
| InChI | InChI=1S/C17H33N3O4/c1-17(2,3)24-16(21)18-15(14-20-8-12-23-13-9-20)4-5-19-6-10-22-11-7-19/h15H,4-14H2,1-3H3,(H,18,21)/t15-/m1/s1 |
| InChIKey | RMNZCGKGFUDCFI-OAHLLOKOSA-N |
| XLogP | 0.93 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |