C15H13F13O4 — CID 121401313
[3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]-2-methylbutan-2-yl] but-3-enoate (PubChem CID 121401313) has the molecular formula C15H13F13O4 and a molecular weight of 504.24 g/mol. Its IUPAC name is [3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]-2-methylbutan-2-yl] but-3-enoate.
| Compound Name | [3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]-2-methylbutan-2-yl] but-3-enoate |
|---|---|
| PubChem CID | 121401313 |
| Molecular Formula | C15H13F13O4 |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | [3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]-2-methylbutan-2-yl] but-3-enoate |
| SMILES | C=CCC(=O)OC(C)(C)C(F)(OC(F)(F)C(F)(OC(F)(F)C(=C)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H13F13O4/c1-5-6-8(29)30-9(3,4)11(19,13(21,22)23)32-15(27,28)12(20,14(24,25)26)31-10(17,18)7(2)16/h5H,1-2,6H2,3-4H3 |
| InChIKey | AGZSSSMDIZJQPE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|