About 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine
4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 121401340) has the molecular formula C17H16N6O2
and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine |
| PubChem CID | 121401340 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | Cc1cnc(COc2nc(N)nc3ccn(Cc4ccccn4)c23)o1 |
| InChI | InChI=1S/C17H16N6O2/c1-11-8-20-14(25-11)10-24-16-15-13(21-17(18)22-16)5-7-23(15)9-12-4-2-3-6-19-12/h2-8H,9-10H2,1H3,(H2,18,21,22) |
| InChIKey | SOQXYEGWTMCTSF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine?
The IUPAC name of 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine (CID 121401340) is 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine is Cc1cnc(COc2nc(N)nc3ccn(Cc4ccccn4)c23)o1.
What is the InChIKey of 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine?
The InChIKey is SOQXYEGWTMCTSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N6O2/c1-11-8-20-14(25-11)10-24-16-15-13(21-17(18)22-16)5-7-23(15)9-12-4-2-3-6-19-12/h2-8H,9-10H2,1H3,(H2,18,21,22).
What are the key properties of 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine?
4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine has a molecular weight of 336.36 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-1,3-oxazol-2-yl)methoxy]-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 121401340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).