C36H21F9N2O3S — CID 121402376
[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 121402376) has the molecular formula C36H21F9N2O3S and a molecular weight of 732.62 g/mol. Its IUPAC name is [4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 121402376 |
| Molecular Formula | C36H21F9N2O3S |
| Molecular Weight | 732.62 g/mol |
| Exact Mass | 732.11 |
| IUPAC Name | [4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c2ccccc12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H21F9N2O3S/c37-33(38,35(41,42)43)34(39,40)36(44,45)51(48,49)50-31-20-19-26(27-13-7-8-14-28(27)31)22-15-17-24(18-16-22)30-21-29(23-9-3-1-4-10-23)46-32(47-30)25-11-5-2-6-12-25/h1-21H |
| InChIKey | CMGKGVGWGXXNDE-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.62 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|