C26H24ClF3N4 — CID 121402499
N-[8-chloro-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402499) has the molecular formula C26H24ClF3N4 and a molecular weight of 484.95 g/mol. Its IUPAC name is N-[8-chloro-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[8-chloro-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402499 |
| Molecular Formula | C26H24ClF3N4 |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[8-chloro-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2cc(-c3ccccc3)cc(C(F)(F)F)c2)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C26H24ClF3N4/c1-34(2)13-7-12-31-25-21-10-6-11-22(27)23(21)32-24(33-25)19-14-18(17-8-4-3-5-9-17)15-20(16-19)26(28,29)30/h3-6,8-11,14-16H,7,12-13H2,1-2H3,(H,31,32,33) |
| InChIKey | HPYOKQTXTFLFQZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|