C21H19BrF6N4 — CID 121402781
N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402781) has the molecular formula C21H19BrF6N4 and a molecular weight of 521.30 g/mol. Its IUPAC name is N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402781 |
| Molecular Formula | C21H19BrF6N4 |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2cc(Br)cc(C(F)(F)F)c2)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C21H19BrF6N4/c1-32(2)8-4-7-29-19-15-5-3-6-16(21(26,27)28)17(15)30-18(31-19)12-9-13(20(23,24)25)11-14(22)10-12/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,29,30,31) |
| InChIKey | UWKWLFKAENXDHM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|