C27H26ClF3N4 — CID 121402792
N-[2-[3-(2-chlorophenyl)-5-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402792) has the molecular formula C27H26ClF3N4 and a molecular weight of 498.98 g/mol. Its IUPAC name is N-[2-[3-(2-chlorophenyl)-5-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[3-(2-chlorophenyl)-5-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402792 |
| Molecular Formula | C27H26ClF3N4 |
| Molecular Weight | 498.98 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[2-[3-(2-chlorophenyl)-5-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cccc2c(NCCCN(C)C)nc(-c3cc(-c4ccccc4Cl)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C27H26ClF3N4/c1-17-8-6-10-22-24(17)33-25(34-26(22)32-12-7-13-35(2)3)19-14-18(15-20(16-19)27(29,30)31)21-9-4-5-11-23(21)28/h4-6,8-11,14-16H,7,12-13H2,1-3H3,(H,32,33,34) |
| InChIKey | VOEMJXZMWTYVSU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.98 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|