C21H22BrF3N4 — CID 121402800
N-[2-[4-bromo-3-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402800) has the molecular formula C21H22BrF3N4 and a molecular weight of 467.33 g/mol. Its IUPAC name is N-[2-[4-bromo-3-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[4-bromo-3-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402800 |
| Molecular Formula | C21H22BrF3N4 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-[4-bromo-3-(trifluoromethyl)phenyl]-8-methylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cccc2c(NCCCN(C)C)nc(-c3ccc(Br)c(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C21H22BrF3N4/c1-13-6-4-7-15-18(13)27-19(28-20(15)26-10-5-11-29(2)3)14-8-9-17(22)16(12-14)21(23,24)25/h4,6-9,12H,5,10-11H2,1-3H3,(H,26,27,28) |
| InChIKey | GGCIFAUNLTZUCL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|