C26H23ClF4N4 — CID 121402808
N-[8-chloro-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402808) has the molecular formula C26H23ClF4N4 and a molecular weight of 502.94 g/mol. Its IUPAC name is N-[8-chloro-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[8-chloro-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402808 |
| Molecular Formula | C26H23ClF4N4 |
| Molecular Weight | 502.94 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N-[8-chloro-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]phenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2cccc(-c3cc(F)cc(C(F)(F)F)c3)c2)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C26H23ClF4N4/c1-35(2)11-5-10-32-25-21-8-4-9-22(27)23(21)33-24(34-25)17-7-3-6-16(12-17)18-13-19(26(29,30)31)15-20(28)14-18/h3-4,6-9,12-15H,5,10-11H2,1-2H3,(H,32,33,34) |
| InChIKey | QTWAGHYHRUCMRD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.94 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|