C22H24BrF3N4 — CID 121402812
N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-5,8-dimethylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402812) has the molecular formula C22H24BrF3N4 and a molecular weight of 481.36 g/mol. Its IUPAC name is N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-5,8-dimethylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-5,8-dimethylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402812 |
| Molecular Formula | C22H24BrF3N4 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-5,8-dimethylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1ccc(C)c2c(NCCCN(C)C)nc(-c3cc(Br)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C22H24BrF3N4/c1-13-6-7-14(2)19-18(13)21(27-8-5-9-30(3)4)29-20(28-19)15-10-16(22(24,25)26)12-17(23)11-15/h6-7,10-12H,5,8-9H2,1-4H3,(H,27,28,29) |
| InChIKey | BZMREKXBUJMXAT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|