C27H26BrF3N4 — CID 121402855
N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-7-phenylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402855) has the molecular formula C27H26BrF3N4 and a molecular weight of 543.43 g/mol. Its IUPAC name is N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-7-phenylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-7-phenylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402855 |
| Molecular Formula | C27H26BrF3N4 |
| Molecular Weight | 543.43 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | N-[2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-7-phenylquinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1c(-c2ccccc2)ccc2c(NCCCN(C)C)nc(-c3cc(Br)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C27H26BrF3N4/c1-17-22(18-8-5-4-6-9-18)10-11-23-24(17)33-25(34-26(23)32-12-7-13-35(2)3)19-14-20(27(29,30)31)16-21(28)15-19/h4-6,8-11,14-16H,7,12-13H2,1-3H3,(H,32,33,34) |
| InChIKey | BQXNMTFDPWWHHP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.43 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|