C14H19NO3 — CID 121402947
5-butyl-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione (PubChem CID 121402947) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-butyl-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-butyl-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 121402947 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 5-butyl-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione |
| SMILES | C=CC1OC(C=C)C2C(=O)N(CCCC)C(=O)C12 |
| InChI | InChI=1S/C14H19NO3/c1-4-7-8-15-13(16)11-9(5-2)18-10(6-3)12(11)14(15)17/h5-6,9-12H,2-4,7-8H2,1H3 |
| InChIKey | LWXGRVIPTCFYJL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|