C21H38N2OS — CID 121402950
(3aS,4S,6aR)-4-(5-methylidenepentadecyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 121402950) has the molecular formula C21H38N2OS and a molecular weight of 366.62 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(5-methylidenepentadecyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-(5-methylidenepentadecyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 121402950 |
| Molecular Formula | C21H38N2OS |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (3aS,4S,6aR)-4-(5-methylidenepentadecyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | C=C(CCCCCCCCCC)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C21H38N2OS/c1-3-4-5-6-7-8-9-10-13-17(2)14-11-12-15-19-20-18(16-25-19)22-21(24)23-20/h18-20H,2-16H2,1H3,(H2,22,23,24)/t18-,19-,20-/m0/s1 |
| InChIKey | UOPCSZRLIVXRGH-UFYCRDLUSA-N |
| XLogP | 5.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|