C13H23N3OS — CID 121402951
(3aS,4S,6aR)-4-[5-(ethylamino)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 121402951) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[5-(ethylamino)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-[5-(ethylamino)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 121402951 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (3aS,4S,6aR)-4-[5-(ethylamino)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | C=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCC |
| InChI | InChI=1S/C13H23N3OS/c1-3-14-9(2)6-4-5-7-11-12-10(8-18-11)15-13(17)16-12/h10-12,14H,2-8H2,1H3,(H2,15,16,17)/t10-,11-,12-/m0/s1 |
| InChIKey | UPMYLJBBKWBGGH-SRVKXCTJSA-N |
| XLogP | 1.84 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|