C21H36N2OS2 — CID 121402952
(3aS,4S,6aR)-4-[5-(2-methylidenenonylsulfanyl)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 121402952) has the molecular formula C21H36N2OS2 and a molecular weight of 396.67 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[5-(2-methylidenenonylsulfanyl)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-[5-(2-methylidenenonylsulfanyl)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 121402952 |
| Molecular Formula | C21H36N2OS2 |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3aS,4S,6aR)-4-[5-(2-methylidenenonylsulfanyl)hex-5-enyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | C=C(CCCCCCC)CSC(=C)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C21H36N2OS2/c1-4-5-6-7-8-11-16(2)14-25-17(3)12-9-10-13-19-20-18(15-26-19)22-21(24)23-20/h18-20H,2-15H2,1H3,(H2,22,23,24)/t18-,19-,20-/m0/s1 |
| InChIKey | DUGZVGZPXKJZQC-UFYCRDLUSA-N |
| XLogP | 5.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|