C28H25N9O3S — CID 121403099
4-[6-amino-9-[3-[4-(dimethylamino)but-2-ynoylamino]phenyl]-8-oxopurin-7-yl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 121403099) has the molecular formula C28H25N9O3S and a molecular weight of 567.64 g/mol. Its IUPAC name is 4-[6-amino-9-[3-[4-(dimethylamino)but-2-ynoylamino]phenyl]-8-oxopurin-7-yl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[6-amino-9-[3-[4-(dimethylamino)but-2-ynoylamino]phenyl]-8-oxopurin-7-yl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 121403099 |
| Molecular Formula | C28H25N9O3S |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 4-[6-amino-9-[3-[4-(dimethylamino)but-2-ynoylamino]phenyl]-8-oxopurin-7-yl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(-n3c(=O)n(-c4cccc(NC(=O)C#CCN(C)C)c4)c4ncnc(N)c43)cc2)s1 |
| InChI | InChI=1S/C28H25N9O3S/c1-17-15-30-27(41-17)34-26(39)18-9-11-20(12-10-18)36-23-24(29)31-16-32-25(23)37(28(36)40)21-7-4-6-19(14-21)33-22(38)8-5-13-35(2)3/h4,6-7,9-12,14-16H,13H2,1-3H3,(H,33,38)(H2,29,31,32)(H,30,34,39) |
| InChIKey | YZDSNNPYPWHWCA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|