C19H13ClF3N3O2 — CID 121403144
(5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3,4-trifluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 121403144) has the molecular formula C19H13ClF3N3O2 and a molecular weight of 407.78 g/mol. Its IUPAC name is (5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3,4-trifluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3,4-trifluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121403144 |
| Molecular Formula | C19H13ClF3N3O2 |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3,4-trifluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2c[nH]c3c(Cl)cccc23)C(=O)N1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H13ClF3N3O2/c20-12-3-1-2-11-10(7-24-17(11)12)6-14-18(27)26(19(28)25-14)8-9-4-5-13(21)16(23)15(9)22/h1-5,7,14,24H,6,8H2,(H,25,28)/t14-/m1/s1 |
| InChIKey | BJNDHVYPPOLMLO-CQSZACIVSA-N |
| XLogP | 3.90 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|