C20H14ClF4N3O2 — CID 121403155
(5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 121403155) has the molecular formula C20H14ClF4N3O2 and a molecular weight of 439.80 g/mol. Its IUPAC name is (5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121403155 |
| Molecular Formula | C20H14ClF4N3O2 |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (5R)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2c[nH]c3c(Cl)cccc23)C(=O)N1Cc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C20H14ClF4N3O2/c21-14-6-2-4-12-11(8-26-17(12)14)7-15-18(29)28(19(30)27-15)9-10-3-1-5-13(16(10)22)20(23,24)25/h1-6,8,15,26H,7,9H2,(H,27,30)/t15-/m1/s1 |
| InChIKey | LCPIAGIRJRZEIO-OAHLLOKOSA-N |
| XLogP | 4.64 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|