C19H14ClF2N3O2 — CID 121403194
5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3-difluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 121403194) has the molecular formula C19H14ClF2N3O2 and a molecular weight of 389.79 g/mol. Its IUPAC name is 5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3-difluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3-difluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121403194 |
| Molecular Formula | C19H14ClF2N3O2 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 5-[(7-chloro-1H-indol-3-yl)methyl]-3-[(2,3-difluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2c[nH]c3c(Cl)cccc23)C(=O)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C19H14ClF2N3O2/c20-13-5-2-4-12-11(8-23-17(12)13)7-15-18(26)25(19(27)24-15)9-10-3-1-6-14(21)16(10)22/h1-6,8,15,23H,7,9H2,(H,24,27) |
| InChIKey | XRBMQVDZRXTVTA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|