C18H30F8O3 — CID 121403318
2-(hydroxymethyl)-2-(4,4,5,5,6,6,7,7-octafluorotetradecyl)propane-1,3-diol (PubChem CID 121403318) has the molecular formula C18H30F8O3 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(4,4,5,5,6,6,7,7-octafluorotetradecyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(4,4,5,5,6,6,7,7-octafluorotetradecyl)propane-1,3-diol |
|---|---|
| PubChem CID | 121403318 |
| Molecular Formula | C18H30F8O3 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-(hydroxymethyl)-2-(4,4,5,5,6,6,7,7-octafluorotetradecyl)propane-1,3-diol |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(CO)(CO)CO |
| InChI | InChI=1S/C18H30F8O3/c1-2-3-4-5-6-9-15(19,20)17(23,24)18(25,26)16(21,22)10-7-8-14(11-27,12-28)13-29/h27-29H,2-13H2,1H3 |
| InChIKey | BALATYWSJZRHOS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|