C20H30F12O3 — CID 121403350
2-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorohexadecyl)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 121403350) has the molecular formula C20H30F12O3 and a molecular weight of 546.43 g/mol. Its IUPAC name is 2-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorohexadecyl)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorohexadecyl)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 121403350 |
| Molecular Formula | C20H30F12O3 |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 2-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorohexadecyl)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(CO)(CO)CO |
| InChI | InChI=1S/C20H30F12O3/c1-2-3-4-5-6-9-15(21,22)17(25,26)19(29,30)20(31,32)18(27,28)16(23,24)10-7-8-14(11-33,12-34)13-35/h33-35H,2-13H2,1H3 |
| InChIKey | IFSRSTFSSMLTMW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|