C14H23F8NO — CID 121403424
2-(2,2,3,3,4,4,5,5-octafluorododecoxy)ethanamine (PubChem CID 121403424) has the molecular formula C14H23F8NO and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluorododecoxy)ethanamine.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluorododecoxy)ethanamine |
|---|---|
| PubChem CID | 121403424 |
| Molecular Formula | C14H23F8NO |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluorododecoxy)ethanamine |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COCCN |
| InChI | InChI=1S/C14H23F8NO/c1-2-3-4-5-6-7-11(15,16)13(19,20)14(21,22)12(17,18)10-24-9-8-23/h2-10,23H2,1H3 |
| InChIKey | WMZPHKHKRFPPMP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|