C13H21F8NO2 — CID 121403427
2-(2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexoxy)ethanamine (PubChem CID 121403427) has the molecular formula C13H21F8NO2 and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexoxy)ethanamine.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexoxy)ethanamine |
|---|---|
| PubChem CID | 121403427 |
| Molecular Formula | C13H21F8NO2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexoxy)ethanamine |
| SMILES | CCCCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COCCN |
| InChI | InChI=1S/C13H21F8NO2/c1-2-3-4-6-23-8-10(14,15)12(18,19)13(20,21)11(16,17)9-24-7-5-22/h2-9,22H2,1H3 |
| InChIKey | GYCZIVDFTNTLEL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|