C17H29F8NO — CID 121403474
6,6,7,7,8,8,9,9-octafluoro-1-(methylamino)hexadecan-2-ol (PubChem CID 121403474) has the molecular formula C17H29F8NO and a molecular weight of 415.41 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9-octafluoro-1-(methylamino)hexadecan-2-ol.
| Compound Name | 6,6,7,7,8,8,9,9-octafluoro-1-(methylamino)hexadecan-2-ol |
|---|---|
| PubChem CID | 121403474 |
| Molecular Formula | C17H29F8NO |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 6,6,7,7,8,8,9,9-octafluoro-1-(methylamino)hexadecan-2-ol |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(O)CNC |
| InChI | InChI=1S/C17H29F8NO/c1-3-4-5-6-7-10-14(18,19)16(22,23)17(24,25)15(20,21)11-8-9-13(27)12-26-2/h13,26-27H,3-12H2,1-2H3 |
| InChIKey | YHOCFCVWTQEYCF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|