About (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid
(2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid (PubChem CID 121403609) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid |
| PubChem CID | 121403609 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid |
| SMILES | CCC(C)(C)[C@@H](/N=C/CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-5-11(2,3)9(10(14)15)12-7-6-8(13)16-4/h7,9H,5-6H2,1-4H3,(H,14,15)/b12-7+/t9-/m0/s1 |
| InChIKey | KKRZRBLFZFICFQ-SZUMLMDFSA-N |
| XLogP | 1.51 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid?
The IUPAC name of (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid (CID 121403609) is (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid.
What is the SMILES notation for (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid?
The canonical SMILES for (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid is CCC(C)(C)[C@@H](/N=C/CC(=O)OC)C(=O)O.
What is the InChIKey of (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid?
The InChIKey is KKRZRBLFZFICFQ-SZUMLMDFSA-N. The full InChI is InChI=1S/C11H19NO4/c1-5-11(2,3)9(10(14)15)12-7-6-8(13)16-4/h7,9H,5-6H2,1-4H3,(H,14,15)/b12-7+/t9-/m0/s1.
What are the key properties of (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid?
(2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid has a molecular weight of 229.28 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3-methoxy-3-oxopropylidene)amino]-3,3-dimethylpentanoic acid is sourced from PubChem (CID 121403609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).