About [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate
[2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate (PubChem CID 121404038) has the molecular formula C9H9Cl3O3S
and a molecular weight of 303.59 g/mol. Its IUPAC name is [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate.
Molecular Properties
| Compound Name | [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate |
| PubChem CID | 121404038 |
| Molecular Formula | C9H9Cl3O3S |
| Molecular Weight | 303.59 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3O3S/c1-16(13,14)15-9(5-10)7-3-2-6(11)4-8(7)12/h2-4,9H,5H2,1H3 |
| InChIKey | RLMONYZNSJOXOH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate?
The IUPAC name of [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate (CID 121404038) is [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate.
What is the SMILES notation for [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate?
The canonical SMILES for [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate is CS(=O)(=O)OC(CCl)c1ccc(Cl)cc1Cl.
What is the InChIKey of [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate?
The InChIKey is RLMONYZNSJOXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl3O3S/c1-16(13,14)15-9(5-10)7-3-2-6(11)4-8(7)12/h2-4,9H,5H2,1H3.
What are the key properties of [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate?
[2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate has a molecular weight of 303.59 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-1-(2,4-dichlorophenyl)ethyl] methanesulfonate is sourced from PubChem (CID 121404038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).