C32H53N3O7 — CID 121404077
(3S,4R,5R)-5-[[[(3R,5S)-4-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]amino]methyl]-3,4-dimethoxy-N-(2-phenylethyl)oxolane-2-carboxamide (PubChem CID 121404077) has the molecular formula C32H53N3O7 and a molecular weight of 591.79 g/mol. Its IUPAC name is (3S,4R,5R)-5-[[[(3R,5S)-4-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]amino]methyl]-3,4-dimethoxy-N-(2-phenylethyl)oxolane-2-carboxamide.
| Compound Name | (3S,4R,5R)-5-[[[(3R,5S)-4-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]amino]methyl]-3,4-dimethoxy-N-(2-phenylethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121404077 |
| Molecular Formula | C32H53N3O7 |
| Molecular Weight | 591.79 g/mol |
| Exact Mass | 591.39 |
| IUPAC Name | (3S,4R,5R)-5-[[[(3R,5S)-4-[[(2S)-2,3-dimethylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]amino]methyl]-3,4-dimethoxy-N-(2-phenylethyl)oxolane-2-carboxamide |
| SMILES | CC[C@H](C)C([C@@H](CC(=O)NC[C@H]1OC(C(=O)NCCc2ccccc2)[C@@H](OC)[C@@H]1OC)OC)N(C)C(=O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C32H53N3O7/c1-10-21(4)27(35(6)32(38)22(5)20(2)3)24(39-7)18-26(36)34-19-25-28(40-8)29(41-9)30(42-25)31(37)33-17-16-23-14-12-11-13-15-23/h11-15,20-22,24-25,27-30H,10,16-19H2,1-9H3,(H,33,37)(H,34,36)/t21-,22-,24+,25+,27?,28+,29-,30?/m0/s1 |
| InChIKey | HAQCBICGEHKSNF-KGXWAHSNSA-N |
| XLogP | 2.83 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |