C20H33N3O7S2 — CID 121404440
6-[[4-[[1-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)propyl]-2-oxopyrimidin-4-yl]amino]-4-oxobutyl]disulfanyl]hexanoic acid (PubChem CID 121404440) has the molecular formula C20H33N3O7S2 and a molecular weight of 491.63 g/mol. Its IUPAC name is 6-[[4-[[1-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)propyl]-2-oxopyrimidin-4-yl]amino]-4-oxobutyl]disulfanyl]hexanoic acid.
| Compound Name | 6-[[4-[[1-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)propyl]-2-oxopyrimidin-4-yl]amino]-4-oxobutyl]disulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 121404440 |
| Molecular Formula | C20H33N3O7S2 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 6-[[4-[[1-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)propyl]-2-oxopyrimidin-4-yl]amino]-4-oxobutyl]disulfanyl]hexanoic acid |
| SMILES | CC[C@@H](OC(CO)CO)n1ccc(NC(=O)CCCSSCCCCCC(=O)O)nc1=O |
| InChI | InChI=1S/C20H33N3O7S2/c1-2-18(30-15(13-24)14-25)23-10-9-16(22-20(23)29)21-17(26)7-6-12-32-31-11-5-3-4-8-19(27)28/h9-10,15,18,24-25H,2-8,11-14H2,1H3,(H,27,28)(H,21,22,26,29)/t18-/m1/s1 |
| InChIKey | LSSSQLAQDUKMAR-GOSISDBHSA-N |
| XLogP | 2.27 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|