C37H40N8O4 — CID 121404958
3-[(2S,4R)-4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(pyrazol-1-ylmethyl)-1,3-dioxolan-2-yl]benzonitrile (PubChem CID 121404958) has the molecular formula C37H40N8O4 and a molecular weight of 660.78 g/mol. Its IUPAC name is 3-[(2S,4R)-4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(pyrazol-1-ylmethyl)-1,3-dioxolan-2-yl]benzonitrile.
| Compound Name | 3-[(2S,4R)-4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(pyrazol-1-ylmethyl)-1,3-dioxolan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 121404958 |
| Molecular Formula | C37H40N8O4 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | 3-[(2S,4R)-4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(pyrazol-1-ylmethyl)-1,3-dioxolan-2-yl]benzonitrile |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6cccn6)(c6cccc(C#N)c6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C37H40N8O4/c1-3-28(2)45-36(46)44(27-40-45)33-10-8-31(9-11-33)41-18-20-42(21-19-41)32-12-14-34(15-13-32)47-24-35-25-48-37(49-35,26-43-17-5-16-39-43)30-7-4-6-29(22-30)23-38/h4-17,22,27-28,35H,3,18-21,24-26H2,1-2H3/t28?,35-,37-/m1/s1 |
| InChIKey | VKGDCIZLYDNTLU-BFJCWTRPSA-N |
| XLogP | 4.75 |
| TPSA | 115.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|