C37H44N8O4 — CID 121405047
2-[(2S,3S)-2-hydroxypentan-3-yl]-4-[4-[4-[4-[[(3S,5S)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 121405047) has the molecular formula C37H44N8O4 and a molecular weight of 664.81 g/mol. Its IUPAC name is 2-[(2S,3S)-2-hydroxypentan-3-yl]-4-[4-[4-[4-[[(3S,5S)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(2S,3S)-2-hydroxypentan-3-yl]-4-[4-[4-[4-[[(3S,5S)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121405047 |
| Molecular Formula | C37H44N8O4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | 2-[(2S,3S)-2-hydroxypentan-3-yl]-4-[4-[4-[4-[[(3S,5S)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CC[C@@H]([C@H](C)O)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@H]5CO[C@](Cn6nccn6)(c6ccccc6)C5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C37H44N8O4/c1-3-35(28(2)46)45-36(47)43(27-40-45)33-11-9-31(10-12-33)41-19-21-42(22-20-41)32-13-15-34(16-14-32)48-24-29-23-37(49-25-29,26-44-38-17-18-39-44)30-7-5-4-6-8-30/h4-18,27-29,35,46H,3,19-26H2,1-2H3/t28-,29-,35-,37+/m0/s1 |
| InChIKey | XHRVGNJGWARIHS-RFLGMLQWSA-N |
| XLogP | 4.30 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|