About N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine
N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine (PubChem CID 121405090) has the molecular formula C15H24F3N
and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine.
Molecular Properties
| Compound Name | N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine |
| PubChem CID | 121405090 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine |
| SMILES | C=C/C(=C\N=C(/CCCC)C(F)(F)F)CCCCC |
| InChI | InChI=1S/C15H24F3N/c1-4-7-9-10-13(6-3)12-19-14(11-8-5-2)15(16,17)18/h6,12H,3-5,7-11H2,1-2H3/b13-12+,19-14+ |
| InChIKey | MDRPFZZRRWAGDY-OGMPJXADSA-N |
| XLogP | 5.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine?
The IUPAC name of N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine (CID 121405090) is N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine.
What is the SMILES notation for N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine?
The canonical SMILES for N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine is C=C/C(=C\N=C(/CCCC)C(F)(F)F)CCCCC.
What is the InChIKey of N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine?
The InChIKey is MDRPFZZRRWAGDY-OGMPJXADSA-N. The full InChI is InChI=1S/C15H24F3N/c1-4-7-9-10-13(6-3)12-19-14(11-8-5-2)15(16,17)18/h6,12H,3-5,7-11H2,1-2H3/b13-12+,19-14+.
What are the key properties of N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine?
N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine has a molecular weight of 275.36 g/mol, XLogP of 5.83, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-ethenylhept-1-enyl]-1,1,1-trifluorohexan-2-imine is sourced from PubChem (CID 121405090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).